
CAS 1094353-66-8
:3-Fluoro-4-methoxy-N-propylbenzenemethanamine
Description:
3-Fluoro-4-methoxy-N-propylbenzenemethanamine, identified by its CAS number 1094353-66-8, is a chemical compound that belongs to the class of substituted phenethylamines. This substance features a benzene ring with a fluorine atom and a methoxy group at the 3 and 4 positions, respectively, along with a propyl chain attached to the nitrogen of the amine group. The presence of the fluorine atom can influence the compound's electronic properties, potentially enhancing its lipophilicity and biological activity. The methoxy group may also contribute to the compound's solubility and reactivity. As an amine, it can participate in various chemical reactions, including alkylation and acylation. The compound's structural characteristics suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, where modifications to the aromatic ring can affect receptor binding and pharmacokinetics. However, specific biological activities and safety profiles would require further investigation through experimental studies.
Formula:C11H16FNO
InChI:InChI=1S/C11H16FNO/c1-3-6-13-8-9-4-5-11(14-2)10(12)7-9/h4-5,7,13H,3,6,8H2,1-2H3
InChI key:InChIKey=RFHMBRORLFERLU-UHFFFAOYSA-N
SMILES:C(NCCC)C1=CC(F)=C(OC)C=C1
Synonyms:- 3-Fluoro-4-methoxy-N-propylbenzenemethanamine
- Benzenemethanamine, 3-fluoro-4-methoxy-N-propyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.