CAS 1094355-55-1

2-(5-Bromo-2-thienyl)-4-thiazoleacetic acid

Description:

2-(5-Bromo-2-thienyl)-4-thiazoleacetic acid is a chemical compound characterized by its unique structural features, which include a thienyl group and a thiazole ring. The presence of a bromine atom at the 5-position of the thienyl moiety contributes to its reactivity and potential biological activity. This compound typically exhibits acidic properties due to the carboxylic acid functional group, which can participate in various chemical reactions, including esterification and salt formation. Its thiazole and thienyl components may impart specific pharmacological properties, making it of interest in medicinal chemistry. The compound's solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature. Additionally, it may be utilized in the synthesis of other chemical entities or as a building block in drug development. Overall, 2-(5-Bromo-2-thienyl)-4-thiazoleacetic acid represents a versatile structure with potential applications in various fields, including pharmaceuticals and agrochemicals.

Formula: C₉H₆BrNO₂S₂

InChI: InChI=1S/C9H6BrNO2S2/c10-7-2-1-6(15-7)9-11-5(4-14-9)3-8(12)13/h1-2,4H,3H2,(H,12,13)

InChI key: InChIKey=ORFOKEUMASJJBP-UHFFFAOYSA-N

SMILES: C(C(O)=O)C=1N=C(SC1)C2=CC=C(Br)S2

Synonyms:

• 2-(5-Bromo-2-thienyl)-4-thiazoleacetic acid
• 4-Thiazoleacetic acid, 2-(5-bromo-2-thienyl)-

2-[2-(5-Bromothiophen-2-yl)-1,3-thiazol-4-yl]acetic acid

CAS: 1094355-55-1

Versatile small molecule scaffold

Formula: C₉H₆BrNO₂S₂

Purity: Min. 95%

Molecular weight: 304.2 g/mol

Ref: 3D-UTB35555