
CAS 1094355-59-5
:4-Hydroxy-3,5-dimethylbenzenecarboximidamide
Description:
4-Hydroxy-3,5-dimethylbenzenecarboximidamide, with the CAS number 1094355-59-5, is an organic compound characterized by its functional groups and structural features. It contains a benzene ring substituted with hydroxyl (-OH) and dimethyl groups, as well as a carboximidamide functional group (-C(=NH)NH2). This compound is likely to exhibit properties typical of aromatic amines and hydroxylated compounds, such as potential solubility in polar solvents and the ability to participate in hydrogen bonding due to the presence of the hydroxyl group. The dimethyl substitutions can influence its steric hindrance and reactivity, potentially affecting its biological activity and interaction with other molecules. Additionally, the presence of the carboximidamide group suggests that it may have applications in medicinal chemistry, possibly as a precursor or intermediate in the synthesis of pharmaceuticals. Overall, the compound's unique structure may confer specific chemical reactivity and biological properties, making it of interest in various fields of research.
Formula:C9H12N2O
InChI:InChI=1S/C9H12N2O/c1-5-3-7(9(10)11)4-6(2)8(5)12/h3-4,12H,1-2H3,(H3,10,11)
InChI key:InChIKey=UKRQBZPYEQMHOY-UHFFFAOYSA-N
SMILES:C(=N)(N)C1=CC(C)=C(O)C(C)=C1
Synonyms:- Benzenecarboximidamide, 4-hydroxy-3,5-dimethyl-
- 4-Hydroxy-3,5-dimethylbenzenecarboximidamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.