CAS 1094363-64-0

2-Chloro-N-[[(2-fluorophenyl)amino]carbonyl]propanamide

Description:

2-Chloro-N-[[(2-fluorophenyl)amino]carbonyl]propanamide is a chemical compound characterized by its specific functional groups and structural features. It contains a chloro substituent, an amide linkage, and a fluorophenyl moiety, which contribute to its unique reactivity and potential biological activity. The presence of the chloro group can influence the compound's polarity and solubility, while the fluorophenyl group may enhance its lipophilicity and biological interactions. This compound is likely to exhibit moderate to high stability under standard conditions, but its reactivity can be influenced by the presence of nucleophiles or electrophiles in its environment. The amide functional group suggests potential for hydrogen bonding, which can affect its solubility in polar solvents. Additionally, the compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that could interact with biological targets. Overall, 2-Chloro-N-[[(2-fluorophenyl)amino]carbonyl]propanamide represents a complex organic molecule with potential significance in various chemical and biological contexts.

Formula: C₁₀H₁₀ClFN₂O₂

InChI: InChI=1S/C10H10ClFN2O2/c1-6(11)9(15)14-10(16)13-8-5-3-2-4-7(8)12/h2-6H,1H3,(H2,13,14,15,16)

InChI key: InChIKey=XMHPNSLHYGRMOM-UHFFFAOYSA-N

SMILES: N(C(NC(C(C)Cl)=O)=O)C1=C(F)C=CC=C1

Synonyms:

• 2-Chloro-N-[[(2-fluorophenyl)amino]carbonyl]propanamide
• Propanamide, 2-chloro-N-[[(2-fluorophenyl)amino]carbonyl]-

3-(2-Chloropropanoyl)-1-(2-fluorophenyl)urea

CAS: 1094363-64-0

Versatile small molecule scaffold

Formula: C₁₀H₁₀ClFN₂O₂

Purity: Min. 95%

Molecular weight: 244.65 g/mol

Ref: 3D-UTB36364