CAS 1094363-99-1

2-[3-(Difluoromethoxy)phenyl]oxirane

Description:

2-[3-(Difluoromethoxy)phenyl]oxirane, identified by its CAS number 1094363-99-1, is a chemical compound characterized by its epoxide functional group, which is a three-membered cyclic ether. This compound features a phenyl ring substituted with a difluoromethoxy group, enhancing its reactivity and potential applications in organic synthesis. The presence of the difluoromethoxy group suggests that the compound may exhibit unique electronic properties, influencing its behavior in chemical reactions. Typically, compounds like this can be involved in various applications, including pharmaceuticals and agrochemicals, due to their ability to participate in nucleophilic ring-opening reactions. The epoxide structure is known for its strain, making it a reactive intermediate in many chemical processes. Additionally, the difluoromethoxy substitution may impart specific characteristics such as increased lipophilicity or altered solubility, which can affect the compound's biological activity and interaction with other molecules. Overall, 2-[3-(Difluoromethoxy)phenyl]oxirane represents a versatile structure in the realm of synthetic organic chemistry.

Formula: C₉H₈F₂O₂

InChI: InChI=1S/C9H8F2O2/c10-9(11)13-7-3-1-2-6(4-7)8-5-12-8/h1-4,8-9H,5H2

InChI key: InChIKey=XOVZKVOPPAPTDG-UHFFFAOYSA-N

SMILES: O(C(F)F)C=1C=C(C2CO2)C=CC1

Synonyms:

• Oxirane, 2-[3-(difluoromethoxy)phenyl]-
• 2-[3-(Difluoromethoxy)phenyl]oxirane