CAS 1094385-33-7: 5-(3,4-Dimethylphenyl)-1,2,4-triazin-3-amine

Description: 5-(3,4-Dimethylphenyl)-1,2,4-triazin-3-amine is an organic compound characterized by its triazine core, which features a three-membered nitrogen-containing ring. The presence of the 3,4-dimethylphenyl group indicates that the compound has a substituted aromatic ring, contributing to its overall stability and potential reactivity. This compound is likely to exhibit properties typical of triazines, such as being a weak base due to the nitrogen atoms in the ring, which can participate in hydrogen bonding. The presence of the amine functional group suggests that it may engage in nucleophilic reactions and could serve as a ligand in coordination chemistry. Additionally, the specific arrangement of methyl groups on the phenyl ring can influence its solubility, melting point, and biological activity. Compounds of this nature may find applications in pharmaceuticals, agrochemicals, or materials science, depending on their specific reactivity and interactions with biological systems or other chemical entities. Further studies would be necessary to elucidate its full range of properties and potential applications.

Formula: C₁₁H₁₂N₄

InChI: InChI=1S/C11H12N4/c1-7-3-4-9(5-8(7)2)10-6-13-15-11(12)14-10/h3-6H,1-2H3,(H2,12,14,15)

InChI key: InChIKey=PYUINXLDECWNGA-UHFFFAOYSA-N

SMILES: N1=NC(=NC(=C1)C2=CC=C(C(=C2)C)C)N

Synonyms:

• 1,2,4-Triazin-3-amine, 5-(3,4-dimethylphenyl)-
• 5-(3,4-Dimethylphenyl)-1,2,4-triazin-3-amine

5-(3,4-Dimethylphenyl)-1,2,4-triazin-3-amine

CAS: 1094385-33-7

Versatile small molecule scaffold

• Formula: C₁₁H₁₂N₄
• Purity: Min. 95%
• Molecular weight: 200.24 g/mol

5-(3,4-Dimethylphenyl)-1,2,4-triazin-3-amine

CAS: 1094385-33-7

• Purity: 95%
• Molecular weight: 200.2449951171875