
CAS 1094424-71-1
:5-(4-Chlorophenyl)-α-methyl-2-thiophenemethanamine
Description:
5-(4-Chlorophenyl)-α-methyl-2-thiophenemethanamine, identified by its CAS number 1094424-71-1, is a chemical compound that belongs to the class of substituted phenyl and thiophene derivatives. This compound features a thiophene ring, which is a five-membered aromatic heterocycle containing sulfur, and is substituted with a chlorophenyl group and an α-methyl group. The presence of the 4-chlorophenyl moiety suggests potential applications in medicinal chemistry, as chlorinated aromatic compounds often exhibit interesting biological activities. The α-methyl group can influence the compound's steric and electronic properties, potentially affecting its reactivity and interaction with biological targets. Additionally, the thiophene ring can contribute to the compound's overall stability and solubility characteristics. While specific biological activities and applications may vary, compounds of this nature are often explored for their potential use in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. Further studies would be necessary to elucidate its specific properties and potential applications in various fields.
Formula:C12H12ClNS
InChI:InChI=1S/C12H12ClNS/c1-8(14)11-6-7-12(15-11)9-2-4-10(13)5-3-9/h2-8H,14H2,1H3
InChI key:InChIKey=UIYCHXWDEXLYLO-UHFFFAOYSA-N
SMILES:C(C)(N)C=1SC(=CC1)C2=CC=C(Cl)C=C2
Synonyms:- 2-Thiophenemethanamine, 5-(4-chlorophenyl)-α-methyl-
- 5-(4-Chlorophenyl)-α-methyl-2-thiophenemethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.