CymitQuimica logo

CAS 1094442-47-3

:

4-Amino-N-[2-(difluoromethoxy)phenyl]benzeneacetamide

Description:
4-Amino-N-[2-(difluoromethoxy)phenyl]benzeneacetamide, identified by its CAS number 1094442-47-3, is a chemical compound characterized by its amine and acetamide functional groups, which contribute to its potential biological activity. The presence of a difluoromethoxy group indicates that it contains fluorine atoms, which can enhance the compound's lipophilicity and influence its interaction with biological targets. This compound is likely to exhibit moderate solubility in organic solvents due to its aromatic structure and polar functional groups. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as compounds with similar structures often exhibit significant biological activity. Additionally, the presence of the amino group may allow for further derivatization, enhancing its pharmacological properties. Safety and handling precautions should be observed, as with any chemical substance, particularly those with potential biological activity. Further studies would be necessary to fully elucidate its properties, including stability, reactivity, and specific biological effects.
Formula:C15H14F2N2O2
InChI:InChI=1S/C15H14F2N2O2/c16-15(17)21-13-4-2-1-3-12(13)19-14(20)9-10-5-7-11(18)8-6-10/h1-8,15H,9,18H2,(H,19,20)
InChI key:InChIKey=DDOZFPWDMHOGDS-UHFFFAOYSA-N
SMILES:N(C(CC1=CC=C(N)C=C1)=O)C2=C(OC(F)F)C=CC=C2
Synonyms:
  • Benzeneacetamide, 4-amino-N-[2-(difluoromethoxy)phenyl]-
  • 4-Amino-N-[2-(difluoromethoxy)phenyl]benzeneacetamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.