CAS 1094462-45-9

Cyclobutyl-1H-indol-3-ylmethanone

Description:

Cyclobutyl-1H-indol-3-ylmethanone, identified by its CAS number 1094462-45-9, is a chemical compound that features a cyclobutyl group attached to an indole structure, specifically at the 3-position of the indole ring. This compound is characterized by its unique bicyclic structure, which combines the properties of both cyclobutane and indole, contributing to its potential biological activity. The presence of the carbonyl group (ketone) at the methanone position enhances its reactivity and may influence its interactions in biological systems. Cyclobutyl-1H-indol-3-ylmethanone may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry and drug development. Its solubility, stability, and reactivity can vary based on the specific conditions and solvents used. As with many organic compounds, understanding its structure-activity relationship is crucial for exploring its potential applications in various fields, including pharmaceuticals and materials science. Further studies are necessary to fully elucidate its properties and potential uses.

Formula: C₁₃H₁₃NO

InChI: InChI=1S/C13H13NO/c15-13(9-4-3-5-9)11-8-14-12-7-2-1-6-10(11)12/h1-2,6-9,14H,3-5H2

InChI key: InChIKey=JIKVYTPAMRINIF-UHFFFAOYSA-N

SMILES: C(=O)(C=1C=2C(NC1)=CC=CC2)C3CCC3

Synonyms:

• Methanone, cyclobutyl-1H-indol-3-yl-
• Cyclobutyl-1H-indol-3-ylmethanone