CAS 109458-75-5
:(11β,16α)-16,17-[Butylidenebis(oxy)]-11,21-dihydroxypregna-1,4,6-triene-3,20-dione
Description:
The chemical substance known as "(11β,16α)-16,17-[Butylidenebis(oxy)]-11,21-dihydroxypregna-1,4,6-triene-3,20-dione," with the CAS number 109458-75-5, is a synthetic steroid compound. It features a complex structure characterized by multiple hydroxyl groups, which contribute to its potential biological activity. The presence of the butylidenebis(oxy) moiety suggests that it may exhibit unique pharmacological properties, possibly influencing steroid hormone activity. This compound is likely to interact with steroid receptors, which could lead to various physiological effects. Its structural configuration indicates that it may be involved in research related to hormonal therapies or anti-inflammatory applications. As with many steroid derivatives, its solubility, stability, and reactivity can vary significantly based on environmental conditions and the presence of other chemical species. Further studies would be necessary to fully elucidate its biological effects, mechanisms of action, and potential therapeutic uses.
Formula:C25H32O6
InChI:InChI=1S/C25H32O6/c1-4-5-21-30-20-11-17-16-7-6-14-10-15(27)8-9-23(14,2)22(16)18(28)12-24(17,3)25(20,31-21)19(29)13-26/h6-10,16-18,20-22,26,28H,4-5,11-13H2,1-3H3/t16-,17-,18-,20+,21?,22+,23-,24-,25+/m0/s1
InChI key:InChIKey=OFBFHEDLHIWDQX-KWVAZRHASA-N
SMILES:C(CO)(=O)[C@]12[C@]3(C)[C@@](C[C@]1(OC(CCC)O2)[H])([C@]4([C@]([C@@H](O)C3)([C@]5(C)C(C=C4)=CC(=O)C=C5)[H])[H])[H]
Synonyms:- Pregna-1,4,6-triene-3,20-dione, 16,17-[butylidenebis(oxy)]-11,21-dihydroxy-, (11β,16α)-
- (11β,16α)-16,17-[Butylidenebis(oxy)]-11,21-dihydroxypregna-1,4,6-triene-3,20-dione
- Δ6-Budesonide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
