CAS 1094600-72-2

Acetamide, 2-amino-N-(2,5-dichlorophenyl)-, hydrochloride (1:1)

Description:

Acetamide, 2-amino-N-(2,5-dichlorophenyl)-, hydrochloride (1:1) is a chemical compound characterized by its amide functional group, which is derived from acetic acid. This substance features a dichlorophenyl moiety, indicating the presence of two chlorine atoms substituted on a phenyl ring, specifically at the 2 and 5 positions. The hydrochloride form suggests that the compound exists as a salt, enhancing its solubility in water and potentially influencing its biological activity. Typically, compounds of this nature may exhibit various pharmacological properties, making them of interest in medicinal chemistry. The presence of the amino group indicates potential for hydrogen bonding, which can affect the compound's interactions with biological targets. Additionally, the dichlorophenyl group may contribute to the compound's lipophilicity and overall stability. As with many chemical substances, safety data and handling precautions are essential, particularly due to the presence of chlorine, which can pose environmental and health risks.

Formula: C₈H₈Cl₂N₂O·ClH

InChI: InChI=1S/C8H8Cl2N2O.ClH/c9-5-1-2-6(10)7(3-5)12-8(13)4-11;/h1-3H,4,11H2,(H,12,13);1H

InChI key: InChIKey=YXKHRBUZSNWPHP-UHFFFAOYSA-N

SMILES: N(C(CN)=O)C1=C(Cl)C=CC(Cl)=C1.Cl

Synonyms:

• Acetamide, 2-amino-N-(2,5-dichlorophenyl)-, hydrochloride (1:1)