CAS 1094601-63-4

3-Methyl-1-[(3-methylphenyl)methyl]-2-piperazinone

Description:

3-Methyl-1-[(3-methylphenyl)methyl]-2-piperazinone is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. This compound features a methyl group and a 3-methylphenyl group attached to the piperazinone structure, contributing to its unique properties. It is typically classified as an organic compound and may exhibit various biological activities, making it of interest in medicinal chemistry. The presence of the piperazinone moiety suggests potential applications in pharmaceuticals, particularly in the development of psychoactive or therapeutic agents. Its molecular structure indicates that it may possess lipophilic characteristics, influencing its solubility and permeability in biological systems. Additionally, the compound's specific stereochemistry and functional groups can affect its reactivity and interaction with biological targets. As with many piperazine derivatives, it may also be subject to further modifications to enhance its pharmacological profile. Safety and handling considerations should be observed, as with all chemical substances, particularly in laboratory settings.

Formula: C₁₃H₁₈N₂O

InChI: InChI=1S/C13H18N2O/c1-10-4-3-5-12(8-10)9-15-7-6-14-11(2)13(15)16/h3-5,8,11,14H,6-7,9H2,1-2H3

InChI key: InChIKey=BJTCKRDDGJDCAD-UHFFFAOYSA-N

SMILES: C(N1C(=O)C(C)NCC1)C2=CC(C)=CC=C2

Synonyms:

• 2-Piperazinone, 3-methyl-1-[(3-methylphenyl)methyl]-
• 3-Methyl-1-[(3-methylphenyl)methyl]-2-piperazinone