CAS 1094607-31-4

1H-Indole-1-acetic acid, 2,3-dihydro-, hydrochloride (1:1)

Description:

1H-Indole-1-acetic acid, 2,3-dihydro-, hydrochloride (1:1) is a chemical compound that belongs to the class of indole derivatives, which are known for their diverse biological activities. This substance is characterized by its indole structure, which consists of a fused benzene and pyrrole ring, and an acetic acid moiety that contributes to its potential as a plant growth regulator. The hydrochloride form indicates that the compound is a salt, enhancing its solubility in water, which is beneficial for biological applications. This compound may exhibit auxin-like properties, influencing plant growth and development processes such as cell elongation and division. Additionally, its dihydro form suggests that it may have altered reactivity and stability compared to its fully unsaturated counterparts. The specific interactions and mechanisms of action of this compound in biological systems are subjects of ongoing research, particularly in the fields of agriculture and pharmacology. As with many indole derivatives, it may also possess potential therapeutic applications, although further studies are necessary to fully elucidate its properties and effects.

Formula: C₁₀H₁₁NO₂·ClH

InChI: InChI=1S/C10H11NO2.ClH/c12-10(13)7-11-6-5-8-3-1-2-4-9(8)11;/h1-4H,5-7H2,(H,12,13);1H

InChI key: InChIKey=ABRZJQBFXCYXSU-UHFFFAOYSA-N

SMILES: C(C(O)=O)N1C=2C(CC1)=CC=CC2.Cl

Synonyms:

• 1H-Indole-1-acetic acid, 2,3-dihydro-, hydrochloride (1:1)

2,3-dihydro-1-indoleacetic acid hcl

CAS: 1094607-31-4

Versatile small molecule scaffold

Formula: C₁₀H₁₂ClNO₂

Purity: Min. 95%

Molecular weight: 213.66 g/mol

Ref: 3D-UTB60731