CAS 109461-44-1
:2-(4-CHLORO-PHENYL)-2-METHYL-MORPHOLINE
Description:
2-(4-Chloro-phenyl)-2-methyl-morpholine, identified by its CAS number 109461-44-1, is a chemical compound that belongs to the morpholine class of compounds. It features a morpholine ring, which is a six-membered heterocyclic structure containing one nitrogen atom and five carbon atoms. The presence of a 4-chlorophenyl group and a methyl group at the 2-position of the morpholine ring contributes to its unique chemical properties. This compound is typically characterized by its moderate polarity, which can influence its solubility in various solvents. It may exhibit biological activity, making it of interest in pharmaceutical research and development. The chlorophenyl substituent can enhance the compound's lipophilicity, potentially affecting its interaction with biological targets. Additionally, the compound's structure suggests it may participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity and environmental impact.
Formula:C9H15N3O
InChI:InChI=1/C9H15N3O/c1-2-8-11-9(13-12-8)7-4-3-5-10-6-7/h7,10H,2-6H2,1H3
SMILES:CCc1nc(C2CCCNC2)on1
Synonyms:- 3-(3-Ethyl-1,2,4-oxadiazol-5-yl)piperidine
- Piperidine, 3-(3-Ethyl-1,2,4-Oxadiazol-5-Yl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-(4-Chlorophenyl)-2-methylmorpholine, 99%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C11H14ClNOPurity:99%Molecular weight:211.692-(4-Chlorophenyl)-2-methylmorpholine
CAS:2-(4-Chlorophenyl)-2-methylmorpholinePurity:98%Molecular weight:211.69g/mol



