CAS 109461-46-3
:2-(4-FLUOROPHENYL)-2-METHYLMORPHOLINE
Description:
2-(4-Fluorophenyl)-2-methylmorpholine, with the CAS number 109461-46-3, is a chemical compound characterized by its morpholine structure, which includes a morpholine ring substituted with a 4-fluorophenyl group and a methyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential lipophilicity due to the presence of the fluorophenyl group. The fluorine atom can influence the compound's reactivity and biological activity, often enhancing its pharmacological properties. Morpholines are known for their versatility in organic synthesis and can serve as intermediates in the production of pharmaceuticals and agrochemicals. The presence of the fluorine substituent may also affect the compound's solubility and stability. As with many organic compounds, safety data should be consulted to understand its handling, storage, and potential hazards. Overall, 2-(4-Fluorophenyl)-2-methylmorpholine is of interest in various fields, including medicinal chemistry and materials science.
Formula:C11H14FNO
InChI:InChI=1/C11H14FNO/c1-11(8-13-6-7-14-11)9-2-4-10(12)5-3-9/h2-5,13H,6-8H2,1H3
SMILES:CC1(CNCCO1)c1ccc(cc1)F
Synonyms:- Morpholine, 2-(4-Fluorophenyl)-2-Methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
