CAS 109461-69-0

ethyl 4-(6-methylimidazo[1,2-a]pyridin-2-yl)benzoate

Description:

Ethyl 4-(6-methylimidazo[1,2-a]pyridin-2-yl)benzoate is an organic compound characterized by its complex structure, which includes an ethyl ester group and a substituted imidazo-pyridine moiety. This compound features a benzoate functional group, indicating it is an ester derived from benzoic acid. The presence of the imidazo[1,2-a]pyridine ring suggests potential biological activity, as such heterocycles are often found in pharmaceuticals and bioactive compounds. The methyl substitution on the imidazole ring can influence the compound's solubility, reactivity, and interaction with biological targets. Ethyl 4-(6-methylimidazo[1,2-a]pyridin-2-yl)benzoate may exhibit properties such as moderate to high lipophilicity, which can affect its absorption and distribution in biological systems. Additionally, the compound's structure may allow for various synthetic modifications, making it a candidate for further research in medicinal chemistry or material science. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₇H₁₆N₂O₂

InChI: InChI=1/C17H16N2O2/c1-3-21-17(20)14-7-5-13(6-8-14)15-11-19-10-12(2)4-9-16(19)18-15/h4-11H,3H2,1-2H3

SMILES: CCOC(=O)c1ccc(cc1)c1cn2cc(C)ccc2n1

2-[4-(Ethoxycarbonyl)phenyl]-6-methyl-imidazo[1,2-a]pyridine

Controlled Product

CAS: 109461-69-0

Applications An intermediate in the preparation of Zolpidem metabolites
References Klupsch, F., et al.: Chem. Pharm. Bull., 54, 1318 (2006),

Formula: C₁₇H₁₆N₂O₂

Color and Shape: Neat

Molecular weight: 280.32

Ref: TR-E891615