CAS 1094646-24-8

2-Methyl-N1,N1-dipropyl-1,4-benzenediamine

Description:

2-Methyl-N1,N1-dipropyl-1,4-benzenediamine, identified by its CAS number 1094646-24-8, is an organic compound characterized by its structure, which includes a benzene ring substituted with two propyl groups and an amino group at the para positions, along with a methyl group at one of the nitrogen atoms. This compound is typically classified as an aromatic amine due to the presence of the amino groups attached to the aromatic ring. It may exhibit properties such as moderate solubility in organic solvents and potential reactivity due to the amine functional groups, which can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. The presence of the methyl and propyl groups can influence its steric and electronic properties, potentially affecting its reactivity and interactions with other chemical species. Safety considerations are important, as many aromatic amines can be toxic or carcinogenic, necessitating careful handling and disposal in laboratory or industrial settings.

Formula: C₁₃H₂₂N₂

InChI: InChI=1S/C13H22N2/c1-4-8-15(9-5-2)13-7-6-12(14)10-11(13)3/h6-7,10H,4-5,8-9,14H2,1-3H3

InChI key: InChIKey=BVGDQSOFGMPORF-UHFFFAOYSA-N

SMILES: N(CCC)(CCC)C1=C(C)C=C(N)C=C1

Synonyms:

• 2-Methyl-N1,N1-dipropyl-1,4-benzenediamine
• 1,4-Benzenediamine, 2-methyl-N1,N1-dipropyl-