CAS 1094649-73-6

2-[3-(Difluoromethoxy)phenyl]morpholine

Description:

2-[3-(Difluoromethoxy)phenyl]morpholine is a chemical compound characterized by its unique structure, which includes a morpholine ring and a phenyl group substituted with a difluoromethoxy moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as moderate polarity and potential for hydrogen bonding due to the presence of the morpholine nitrogen. The difluoromethoxy group can influence the compound's reactivity and solubility, often enhancing its lipophilicity and potentially affecting its biological activity. It may be utilized in various applications, including medicinal chemistry, where such compounds are explored for their pharmacological properties. The presence of fluorine atoms generally increases metabolic stability and can modulate the electronic properties of the molecule. As with many organic compounds, safety and handling precautions are essential, particularly regarding potential toxicity and environmental impact. Overall, 2-[3-(Difluoromethoxy)phenyl]morpholine represents a class of compounds that may have significant implications in drug development and chemical research.

Formula: C₁₁H₁₃F₂NO₂

InChI: InChI=1S/C11H13F2NO2/c12-11(13)16-9-3-1-2-8(6-9)10-7-14-4-5-15-10/h1-3,6,10-11,14H,4-5,7H2

InChI key: InChIKey=SNOOHUIZKCHLMR-UHFFFAOYSA-N

SMILES: O(C(F)F)C=1C=C(C=CC1)C2CNCCO2

Synonyms:

• 2-[3-(Difluoromethoxy)phenyl]morpholine
• Morpholine, 2-[3-(difluoromethoxy)phenyl]-

2-[3-(Difluoromethoxy)phenyl]morpholine

CAS: 1094649-73-6

Versatile small molecule scaffold

Formula: C₁₁H₁₃F₂NO₂

Purity: Min. 95%

Molecular weight: 229.22 g/mol

Ref: 3D-UTB64973