CAS 109466-87-7
:2-NITRO-4-(TRIFLUOROMETHYL)BENZALDEHYDE
Description:
2-Nitro-4-(trifluoromethyl)benzaldehyde is an organic compound characterized by its aromatic structure, featuring a nitro group and a trifluoromethyl group attached to a benzaldehyde moiety. The presence of the nitro group (-NO2) typically imparts strong electron-withdrawing properties, influencing the compound's reactivity and polarity. The trifluoromethyl group (-CF3) is another potent electron-withdrawing substituent, which can significantly affect the compound's physical and chemical properties, such as solubility and boiling point. This compound is generally used in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. Additionally, its unique functional groups can enhance biological activity, making it a subject of interest in medicinal chemistry. Safety data indicates that, like many nitro and fluorinated compounds, it should be handled with care due to potential toxicity and environmental impact.
Formula:C8H4F3NO3
InChI:InChI=1/C8H4F3NO3/c9-8(10,11)6-2-1-5(4-13)7(3-6)12(14)15/h1-4H
SMILES:c1cc(cc(c1C=O)N(=O)=O)C(F)(F)F
Synonyms:- Benzaldehyde, 2-Nitro-4-(Trifluoromethyl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Nitro-4-(trifluoromethyl)benzaldehyde
CAS:Formula:C8H4F3NO3Purity:98%Color and Shape:SolidMolecular weight:219.11752-Nitro-4-(trifluoromethyl)benzaldehyde
CAS:2-Nitro-4-(trifluoromethyl)benzaldehydePurity:98%Color and Shape:SolidMolecular weight:219.12g/mol2-Nitro-4-(trifluoromethyl)benzaldehyde
CAS:2-Nitro-4-(trifluoromethyl)benzaldehyde is an immunosuppressive agent that binds to the active site of the enzyme nitric oxide synthase, inhibiting its activity. This drug has been shown to be active against human immunocompromised patients and those with a history of melamine exposure. It also inhibits the production of nitric oxide, which is associated with inflammation. 2-Nitro-4-(trifluoromethyl)benzaldehyde has been shown to bind to vinylic positions on proteins, leading to immunosuppression.Formula:C8H4F3NO3Purity:Min. 95%Color and Shape:PowderMolecular weight:219.12 g/mol2-Nitro-4-(trifluoromethyl)benzaldehyde
CAS:Formula:C8H4F3NO3Purity:95%Color and Shape:SolidMolecular weight:219.119



