CAS 109466-87-7

2-NITRO-4-(TRIFLUOROMETHYL)BENZALDEHYDE

Description:

2-Nitro-4-(trifluoromethyl)benzaldehyde is an organic compound characterized by its aromatic structure, featuring a nitro group and a trifluoromethyl group attached to a benzaldehyde moiety. The presence of the nitro group (-NO2) typically imparts strong electron-withdrawing properties, influencing the compound's reactivity and polarity. The trifluoromethyl group (-CF3) is another potent electron-withdrawing substituent, which can significantly affect the compound's physical and chemical properties, such as solubility and boiling point. This compound is generally used in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. Additionally, its unique functional groups can enhance biological activity, making it a subject of interest in medicinal chemistry. Safety data indicates that, like many nitro and fluorinated compounds, it should be handled with care due to potential toxicity and environmental impact.

Formula: C₈H₄F₃NO₃

InChI: InChI=1/C8H4F3NO3/c9-8(10,11)6-2-1-5(4-13)7(3-6)12(14)15/h1-4H

SMILES: c1cc(cc(c1C=O)N(=O)=O)C(F)(F)F

Synonyms:

• Benzaldehyde, 2-Nitro-4-(Trifluoromethyl)-

2-Nitro-4-(trifluoromethyl)benzaldehyde

CAS: 109466-87-7

2-Nitro-4-(trifluoromethyl)benzaldehyde

Formula: C₈H₄F₃NO₃

Purity: 98%

Molecular weight: 219.12

Ref: IN-DG212859

2-Nitro-4-(trifluoromethyl)benzaldehyde

CAS: 109466-87-7

2-Nitro-4-(trifluoromethyl)benzaldehyde

Formula: C₈H₄F₃NO₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 219.11746

Ref: 54-PC01502

2-Nitro-4-(trifluoromethyl)benzaldehyde

CAS: 109466-87-7

Formula: C₈H₄F₃NO₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 219.1175

Ref: IN-DA0033EQ

2-Nitro-4-(trifluoromethyl)benzaldehyde

CAS: 109466-87-7

2-Nitro-4-(trifluoromethyl)benzaldehyde is an immunosuppressive agent that binds to the active site of the enzyme nitric oxide synthase, inhibiting its activity. This drug has been shown to be active against human immunocompromised patients and those with a history of melamine exposure. It also inhibits the production of nitric oxide, which is associated with inflammation. 2-Nitro-4-(trifluoromethyl)benzaldehyde has been shown to bind to vinylic positions on proteins, leading to immunosuppression.

Formula: C₈H₄F₃NO₃

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 219.12 g/mol

Ref: 3D-FN67626

2-Nitro-4-(trifluoromethyl)benzaldehyde

CAS: 109466-87-7

Formula: C₈H₄F₃NO₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 219.119

Ref: 10-F219767