CAS 1094671-85-8

2-Methyl-5-benzoxazolesulfonamide

Description:

2-Methyl-5-benzoxazolesulfonamide is a chemical compound characterized by its unique structure, which includes a benzoxazole ring and a sulfonamide functional group. This compound typically exhibits properties such as moderate solubility in polar solvents due to the presence of the sulfonamide group, which can engage in hydrogen bonding. The benzoxazole moiety contributes to its potential biological activity, as compounds containing this structure are often investigated for their pharmacological properties. The sulfonamide group may enhance the compound's reactivity and interaction with biological targets. Additionally, 2-Methyl-5-benzoxazolesulfonamide may display stability under various conditions, although specific stability data would depend on environmental factors such as pH and temperature. Its molecular weight and specific reactivity can influence its applications in medicinal chemistry and material science. Overall, this compound is of interest for further research, particularly in the context of drug development and synthetic chemistry.

Formula: C₈H₈N₂O₃S

InChI: InChI=1S/C8H8N2O3S/c1-5-10-7-4-6(14(9,11)12)2-3-8(7)13-5/h2-4H,1H3,(H2,9,11,12)

InChI key: InChIKey=VEGVHOUQXJXQRP-UHFFFAOYSA-N

SMILES: S(N)(=O)(=O)C=1C=C2C(=CC1)OC(C)=N2

Synonyms:

• 5-Benzoxazolesulfonamide, 2-methyl-
• 2-Methyl-5-benzoxazolesulfonamide