CAS 1094671-89-2

2-Bromo-1,4-benzenedisulfonamide

Description:

2-Bromo-1,4-benzenedisulfonamide is an organic compound characterized by the presence of a bromine atom and two sulfonamide groups attached to a benzene ring. Its molecular structure features a symmetrical arrangement, with the sulfonamide groups positioned at the 1 and 4 positions of the benzene ring, which contributes to its chemical reactivity and potential applications. The sulfonamide functional groups are known for their ability to form hydrogen bonds, influencing the compound's solubility and interaction with biological systems. This compound may exhibit properties such as moderate to high solubility in polar solvents, and its bromine substituent can enhance its reactivity in electrophilic substitution reactions. Additionally, 2-Bromo-1,4-benzenedisulfonamide may have applications in pharmaceuticals, agrochemicals, or as a reagent in organic synthesis due to its unique functional groups. Safety data should be consulted for handling and potential toxicity, as compounds containing sulfonamide groups can have varying biological effects.

Formula: C₆H₇BrN₂O₄S₂

InChI: InChI=1S/C6H7BrN2O4S2/c7-5-3-4(14(8,10)11)1-2-6(5)15(9,12)13/h1-3H,(H2,8,10,11)(H2,9,12,13)

InChI key: InChIKey=MTQRLTAFULNGCJ-UHFFFAOYSA-N

SMILES: S(N)(=O)(=O)C1=CC(Br)=C(S(N)(=O)=O)C=C1

Synonyms:

• 1,4-Benzenedisulfonamide, 2-bromo-
• 2-Bromo-1,4-benzenedisulfonamide