CymitQuimica logo

CAS 109473-55-4

:

9,10-dimethoxy-2,3,4,6,7,11b-hexahydro-1H-pyrazino[2,1-a]isoquinoline

Description:
9,10-dimethoxy-2,3,4,6,7,11b-hexahydro-1H-pyrazino[2,1-a]isoquinoline is a complex organic compound characterized by its unique bicyclic structure, which includes a pyrazinoisoquinoline framework. This compound features two methoxy groups (-OCH3) attached to the aromatic system, contributing to its chemical reactivity and potential biological activity. The hexahydro configuration indicates that the compound contains multiple saturated carbon atoms, which may influence its physical properties, such as solubility and stability. The presence of nitrogen in the pyrazine ring suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Its molecular structure may also allow for various functionalization, which can be explored for developing derivatives with enhanced properties. The compound's CAS number, 109473-55-4, serves as a unique identifier for regulatory and research purposes, facilitating its study in various chemical and pharmaceutical contexts. Overall, this compound exemplifies the intricate relationship between molecular structure and potential applications in drug discovery and development.
Formula:C14H20N2O2
InChI:InChI=1/C14H20N2O2/c1-17-13-7-10-3-5-16-6-4-15-9-12(16)11(10)8-14(13)18-2/h7-8,12,15H,3-6,9H2,1-2H3
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.