CAS 1094746-55-0
:N1-Cyclohexyl-N1-ethyl-2-methyl-1,4-benzenediamine
Description:
N1-Cyclohexyl-N1-ethyl-2-methyl-1,4-benzenediamine, identified by its CAS number 1094746-55-0, is an organic compound characterized by its structure, which includes a benzene ring substituted with two amino groups (–NH2) at the 1 and 4 positions, as well as cyclohexyl and ethyl groups attached to the nitrogen atoms. This compound is typically a solid at room temperature and may exhibit properties such as moderate solubility in organic solvents, depending on the specific functional groups and their interactions. Its molecular structure suggests potential applications in the synthesis of dyes, polymers, or as a curing agent in epoxy resins. Additionally, due to the presence of amine groups, it may participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Safety data should be consulted, as amines can be hazardous, and appropriate handling procedures should be followed to mitigate any risks associated with exposure.
Formula:C15H24N2
InChI:InChI=1S/C15H24N2/c1-3-17(14-7-5-4-6-8-14)15-10-9-13(16)11-12(15)2/h9-11,14H,3-8,16H2,1-2H3
InChI key:InChIKey=BZTWIDHVBYILDA-UHFFFAOYSA-N
SMILES:N(CC)(C1=C(C)C=C(N)C=C1)C2CCCCC2
Synonyms:- 1,4-Benzenediamine, N1-cyclohexyl-N1-ethyl-2-methyl-
- N1-Cyclohexyl-N1-ethyl-2-methyl-1,4-benzenediamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.