
CAS 1094755-12-0
:3-Methoxy-N,4-dimethylbenzenemethanamine
Description:
3-Methoxy-N,4-dimethylbenzenemethanamine, identified by its CAS number 1094755-12-0, is an organic compound characterized by a methoxy group and a dimethyl-substituted aromatic ring. This compound features a benzene ring with a methoxy (-OCH3) group positioned at the meta position relative to the amine group, and two methyl (-CH3) groups at the para position. The presence of the amine functional group (-NH2) indicates that it can participate in various chemical reactions, including nucleophilic substitutions and hydrogen bonding. The methoxy group contributes to the compound's solubility in organic solvents and may influence its reactivity and biological activity. Additionally, the steric hindrance introduced by the dimethyl groups can affect the compound's conformation and interaction with other molecules. Overall, 3-Methoxy-N,4-dimethylbenzenemethanamine is of interest in fields such as medicinal chemistry and materials science, where its unique structural features may confer specific properties or activities.
Formula:C10H15NO
InChI:InChI=1S/C10H15NO/c1-8-4-5-9(7-11-2)6-10(8)12-3/h4-6,11H,7H2,1-3H3
InChI key:InChIKey=UATTXFAMYIWOSD-UHFFFAOYSA-N
SMILES:O(C)C1=CC(CNC)=CC=C1C
Synonyms:- 3-Methoxy-N,4-dimethylbenzenemethanamine
- Benzenemethanamine, 3-methoxy-N,4-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.