CAS 1094760-75-4

2-Propoxy-3-quinolinecarboxylic acid

Description:

2-Propoxy-3-quinolinecarboxylic acid is an organic compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom. This substance features a propoxy group (-O-CH2-CH(CH3)-) attached to the second position of the quinoline ring and a carboxylic acid group (-COOH) at the third position. The presence of these functional groups contributes to its chemical reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The compound is likely to exhibit moderate solubility in organic solvents and limited solubility in water due to the hydrophobic nature of the quinoline ring and the hydrophilic carboxylic acid group. Its molecular structure suggests potential for hydrogen bonding and interactions with biological targets, making it of interest for medicinal chemistry. Additionally, the compound may exhibit specific biological activities, although detailed studies would be necessary to elucidate its pharmacological properties and mechanisms of action.

Formula: C₁₃H₁₃NO₃

InChI: InChI=1S/C13H13NO3/c1-2-7-17-12-10(13(15)16)8-9-5-3-4-6-11(9)14-12/h3-6,8H,2,7H2,1H3,(H,15,16)

InChI key: InChIKey=OKXRKSVCQCZTEZ-UHFFFAOYSA-N

SMILES: O(CCC)C=1C(C(O)=O)=CC2=C(N1)C=CC=C2

Synonyms:

• 3-Quinolinecarboxylic acid, 2-propoxy-
• 2-Propoxy-3-quinolinecarboxylic acid

2-Propoxyquinoline-3-carboxylic acid

CAS: 1094760-75-4

Versatile small molecule scaffold

Formula: C₁₃H₁₃NO₃

Purity: Min. 95%

Molecular weight: 231.25 g/mol

Ref: 3D-UTB76075