
CAS 1094770-15-6
:2-Quinolinemethanesulfonamide
Description:
2-Quinolinemethanesulfonamide is a chemical compound characterized by its unique structure, which includes a quinoline ring fused to a methanesulfonamide group. This compound typically exhibits properties associated with both aromatic and sulfonamide functionalities, contributing to its potential biological activity. It is generally a solid at room temperature and may be soluble in polar solvents due to the presence of the sulfonamide group, which can engage in hydrogen bonding. The compound's sulfonamide moiety is known for its pharmacological relevance, often exhibiting antibacterial and diuretic properties. Additionally, the quinoline structure is associated with various biological activities, including antimalarial and anticancer effects. The compound's reactivity may be influenced by the electron-withdrawing nature of the sulfonamide group, which can affect its interaction with biological targets. Overall, 2-Quinolinemethanesulfonamide represents a class of compounds that may have significant implications in medicinal chemistry and drug development.
Formula:C10H10N2O2S
InChI:InChI=1S/C10H10N2O2S/c11-15(13,14)7-9-6-5-8-3-1-2-4-10(8)12-9/h1-6H,7H2,(H2,11,13,14)
InChI key:InChIKey=SHMHCYRSOJJCOU-UHFFFAOYSA-N
SMILES:C(S(N)(=O)=O)C1=NC2=C(C=C1)C=CC=C2
Synonyms:- 2-Quinolinemethanesulfonamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.