CymitQuimica logo

CAS 109480-87-7

:

3-(Ethylthio)-2-methylpropanoic acid

Description:
3-(Ethylthio)-2-methylpropanoic acid, with the CAS number 109480-87-7, is an organic compound characterized by its carboxylic acid functional group, which imparts acidic properties. This compound features a branched alkyl chain, specifically a 2-methylpropanoic backbone, and an ethylthio substituent, contributing to its unique chemical behavior. The presence of the ethylthio group enhances its reactivity and solubility in organic solvents. Typically, compounds of this nature exhibit moderate to high boiling points due to the presence of hydrogen bonding capabilities associated with the carboxylic acid group. Additionally, they may participate in various chemical reactions, including esterification and nucleophilic substitution, making them valuable in synthetic organic chemistry. The compound's structure suggests potential applications in pharmaceuticals or agrochemicals, where such functional groups can play a crucial role in biological activity or chemical reactivity. Safety data should be consulted for handling and storage, as with all chemical substances, to ensure proper precautions are taken.
Formula:C6H12O2S
InChI:InChI=1S/C6H12O2S/c1-3-9-4-5(2)6(7)8/h5H,3-4H2,1-2H3,(H,7,8)
InChI key:InChIKey=WWBWLALUPIFLAU-UHFFFAOYSA-N
SMILES:C(C(O)=O)(CSCC)C
Synonyms:
  • 3-(Ethylthio)-2-methylpropanoic acid
  • Propanoic acid, 3-(ethylthio)-2-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.