CAS 109485-61-2

2,2,4,4,6,6,8-Heptamethylnonane

Description:

2,2,4,4,6,6,8-Heptamethylnonane is a branched-chain alkane characterized by its complex structure, which includes seven methyl groups attached to a nonane backbone. This compound is a colorless, odorless liquid at room temperature and is insoluble in water, but soluble in organic solvents. It has a high molecular weight and exhibits low volatility, making it stable under standard conditions. The presence of multiple methyl groups contributes to its hydrophobic nature and influences its physical properties, such as boiling and melting points, which are typically higher than those of straight-chain alkanes. Due to its branched structure, it has a lower density compared to linear alkanes. This compound is primarily of interest in research and industrial applications, particularly in the fields of organic chemistry and materials science, where it may serve as a reference compound or in the synthesis of more complex molecules. Safety data indicates that, like many hydrocarbons, it should be handled with care to avoid inhalation or skin contact.

Formula: C₁₆H₃₄

InChI: InChI=1S/C16H34/c1-13(2)10-15(6,7)12-16(8,9)11-14(3,4)5/h13H,10-12H2,1-9H3

InChI key: InChIKey=RDUBCTHNBWFPTP-UHFFFAOYSA-N

SMILES: C(C(CC(C)(C)C)(C)C)C(CC(C)C)(C)C

Synonyms:

• Arlamol HD
• Nonane, 2,2,4,4,6,6,8-heptamethyl-
• 2,2,4,4,6,6,8-Heptamethylnonane