CAS 1094863-26-9
:4-(2-Ethyl-1-piperidinyl)-3-fluorobenzenamine
Description:
4-(2-Ethyl-1-piperidinyl)-3-fluorobenzenamine, identified by its CAS number 1094863-26-9, is a chemical compound characterized by its aromatic amine structure. It features a fluorine atom substituted at the meta position of a benzene ring, which contributes to its unique reactivity and potential biological activity. The presence of a piperidine ring, specifically with an ethyl group at the 2-position, enhances its lipophilicity, potentially influencing its pharmacokinetic properties. This compound may exhibit various interactions due to the amino group, which can participate in hydrogen bonding and act as a nucleophile. Its structural characteristics suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. However, detailed studies on its toxicity, stability, and specific applications would be necessary to fully understand its properties and potential uses in various fields, including drug development and chemical synthesis.
Formula:C13H19FN2
InChI:InChI=1S/C13H19FN2/c1-2-11-5-3-4-8-16(11)13-7-6-10(15)9-12(13)14/h6-7,9,11H,2-5,8,15H2,1H3
InChI key:InChIKey=MFOAUFOHKUWRTB-UHFFFAOYSA-N
SMILES:C(C)C1N(CCCC1)C2=C(F)C=C(N)C=C2
Synonyms:- Benzenamine, 4-(2-ethyl-1-piperidinyl)-3-fluoro-
- 4-(2-Ethyl-1-piperidinyl)-3-fluorobenzenamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.