CAS 1094873-20-7

Piperidine, 2-[2-[(4-methylphenyl)thio]ethyl]-, hydrochloride (1:1)

Description:

Piperidine, 2-[2-[(4-methylphenyl)thio]ethyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. This compound features a thioether functional group, where a sulfur atom is bonded to a 4-methylphenyl group, contributing to its unique properties. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its solubility in water and other polar solvents, making it useful in various applications, including pharmaceuticals and organic synthesis. The presence of the piperidine moiety suggests potential biological activity, as piperidine derivatives are often explored for their pharmacological properties. The compound's molecular interactions may be influenced by the thioether and aromatic groups, which can affect its reactivity and binding affinity in biological systems. Safety data and handling precautions should be considered, as with any chemical substance, particularly in laboratory settings.

Formula: C₁₄H₂₁NS·ClH

InChI: InChI=1S/C14H21NS.ClH/c1-12-5-7-14(8-6-12)16-11-9-13-4-2-3-10-15-13;/h5-8,13,15H,2-4,9-11H2,1H3;1H

InChI key: InChIKey=ORAVFWVTUCJHBB-UHFFFAOYSA-N

SMILES: S(CCC1CCCCN1)C2=CC=C(C)C=C2.Cl

Synonyms:

• Piperidine, 2-[2-[(4-methylphenyl)thio]ethyl]-, hydrochloride (1:1)

2-{2-[(4-methylphenyl)sulfanyl]ethyl}piperidine hydrochloride

CAS: 1094873-20-7

Formula: C₁₄H₂₂ClNS

Purity: 95.0%

Molecular weight: 271.85

Ref: 10-F496350