CAS 1095-85-8
:2-(tritylsulfanyl)ethanamine
Description:
2-(Tritylsulfanyl)ethanamine, with the CAS number 1095-85-8, is an organic compound characterized by the presence of a trityl group (a triphenylmethyl group) attached to a sulfanyl (thioether) functional group, which is further connected to an ethanamine moiety. This compound typically exhibits a white to off-white crystalline appearance and is soluble in organic solvents, reflecting its hydrophobic nature due to the bulky trityl group. The presence of the amine functional group suggests basic properties, allowing it to participate in various chemical reactions, including nucleophilic substitutions and acylation. The trityl group provides steric hindrance, which can influence the reactivity and stability of the compound. Additionally, the sulfanyl group can participate in redox reactions, making this compound potentially useful in synthetic organic chemistry and medicinal chemistry applications. Overall, 2-(tritylsulfanyl)ethanamine is notable for its unique structural features and potential reactivity, which can be leveraged in various chemical syntheses.
Formula:C21H21NS
InChI:InChI=1/C21H21NS/c22-16-17-23-21(18-10-4-1-5-11-18,19-12-6-2-7-13-19)20-14-8-3-9-15-20/h1-15H,16-17,22H2
SMILES:c1ccc(cc1)C(c1ccccc1)(c1ccccc1)SCCN
Synonyms:- 2-(Tritylthio)ethanamine
- 2-(tritylthio)ethan-1-amine
- 2-[(triphenylmethyl)sulfanyl]ethan-1-amine
- 2-tritylthio-1-ethylamine
- Ethanamine, 2-[(triphenylmethyl)thio]-
- 2-(tritylthio)ethanamine,2-[(triphenylmethyl)thio]- Ethanamine
- S-Tritylcysteamine
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Ethanamine, 2-[(triphenylmethyl)thio]-
CAS:Formula:C21H21NSPurity:98%Color and Shape:SolidMolecular weight:319.46312-(Tritylthio)ethanamine
CAS:Controlled Product<p>Applications 2-(Tritylthio)ethanamine is an intermediate in the synthesis of Amifostine Thiol Dihydrochloride-d6 (A576823), which is a metabolite of amifostine.<br>References Satge, J., et al.: Eur. J. Med. Chem., 24, 48 (1989), Geary, R.S., et al.: Biopharm. Drug Dispos., 12, 261 (1991),<br></p>Formula:C21H21NSColor and Shape:NeatMolecular weight:319.46




