CAS 1095010-43-7

1-[4-(Methylsulfonyl)-3-nitrophenyl]piperazine

Description:

1-[4-(Methylsulfonyl)-3-nitrophenyl]piperazine is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. This compound features a para-substituted phenyl group that includes a methylsulfonyl group and a nitro group, contributing to its unique chemical properties. The presence of the methylsulfonyl group enhances its solubility in polar solvents, while the nitro group can influence its reactivity and potential biological activity. The compound is typically a solid at room temperature and may exhibit moderate stability under standard conditions. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. Additionally, the presence of functional groups like the nitro and sulfonyl groups may impart specific interactions with biological targets, making it of interest in drug design and development. Safety and handling precautions should be observed, as with many chemical substances, due to potential toxicity or reactivity.

Formula: C₁₁H₁₅N₃O₄S

InChI: InChI=1S/C11H15N3O4S/c1-19(17,18)11-3-2-9(8-10(11)14(15)16)13-6-4-12-5-7-13/h2-3,8,12H,4-7H2,1H3

InChI key: InChIKey=PXJCLNPAGNIXTJ-UHFFFAOYSA-N

SMILES: N(=O)(=O)C1=C(S(C)(=O)=O)C=CC(=C1)N2CCNCC2

Synonyms:

• Piperazine, 1-[4-(methylsulfonyl)-3-nitrophenyl]-
• 1-[4-(Methylsulfonyl)-3-nitrophenyl]piperazine

N-(4-Methylsulphonyl-3-nitrophenyl)piperazine

CAS: 1095010-43-7

Formula: C₁₁H₁₅N₃O₄S

Purity: 97%

Molecular weight: 285.3195

Ref: IN-DA003SD5

1-(4-(Methylsulfonyl)-3-nitrophenyl)piperazine

CAS: 1095010-43-7

Purity: >97%

Molecular weight: 285.3200073

Ref: 10-F721844