CAS 1095010-44-8
:3-Piperidinecarboxylic acid, 5-hydroxy-, methyl ester
Description:
3-Piperidinecarboxylic acid, 5-hydroxy-, methyl ester, identified by CAS number 1095010-44-8, is a chemical compound characterized by its piperidine ring structure, which is a six-membered nitrogen-containing heterocycle. This compound features a carboxylic acid functional group at the 3-position and a hydroxyl group at the 5-position, with a methyl ester substituent. The presence of these functional groups contributes to its potential as a versatile intermediate in organic synthesis and pharmaceutical applications. The compound is likely to exhibit polar characteristics due to the hydroxyl and carboxyl groups, influencing its solubility in polar solvents. Additionally, the piperidine moiety may impart basic properties, allowing for interactions with various biological targets. Its structural features suggest potential applications in medicinal chemistry, particularly in the development of compounds with biological activity. As with many organic compounds, safety and handling precautions should be observed, as the specific toxicity and reactivity profiles would need to be evaluated in detail for practical applications.
Formula:C7H13NO3
InChI:InChI=1S/C7H13NO3/c1-11-7(10)5-2-6(9)4-8-3-5/h5-6,8-9H,2-4H2,1H3
InChI key:InChIKey=ZAUFCVXOKIPCKG-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1CC(O)CNC1
Synonyms:- 3-Piperidinecarboxylic acid, 5-hydroxy-, methyl ester
- Methyl 5-hydroxypiperidine-3-carboxylate
- 5-Hydroxypiperidine-3-carboxylic acid methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
