CymitQuimica logo

CAS 109515-17-5

:

α-(1-Aminoethyl)-4-iodobenzenemethanol

Description:
α-(1-Aminoethyl)-4-iodobenzenemethanol, with the CAS number 109515-17-5, is a chemical compound characterized by its unique structure that includes an amino group, an iodine atom, and a hydroxymethyl group attached to a benzene ring. This compound typically exhibits properties associated with both amines and alcohols, such as potential solubility in polar solvents and the ability to participate in hydrogen bonding. The presence of the iodine atom may impart specific reactivity, making it useful in various synthetic applications, including medicinal chemistry and organic synthesis. The aminoethyl side chain suggests that it may have biological activity, potentially interacting with biological targets. Additionally, the compound's structure may influence its physical properties, such as melting point and boiling point, which are important for its handling and application in laboratory settings. Safety data should be consulted to understand its toxicity and handling precautions, as compounds containing iodine and amine functionalities can pose specific health risks.
Formula:C9H12INO
InChI:InChI=1S/C9H12INO/c1-6(11)9(12)7-2-4-8(10)5-3-7/h2-6,9,12H,11H2,1H3
InChI key:InChIKey=DVPRMMBBYKNRAE-UHFFFAOYSA-N
SMILES:C(C(C)N)(O)C1=CC=C(I)C=C1
Synonyms:
  • 2-Amino-1-(4-iodophenyl)propan-1-ol
  • Benzenemethanol, α-(1-aminoethyl)-4-iodo-
  • α-(1-Aminoethyl)-4-iodobenzenemethanol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.