CAS 109522-28-3
:5-fluoroarachidonic acid
Description:
5-Fluoroarachidonic acid is a fluorinated derivative of arachidonic acid, which is a polyunsaturated fatty acid involved in various physiological processes, including inflammation and cell signaling. The introduction of a fluorine atom at the 5-position alters its biochemical properties, potentially influencing its interaction with enzymes and receptors. This compound is characterized by its unique structure, which includes a long hydrocarbon chain with multiple double bonds, contributing to its amphiphilic nature. As a fluorinated compound, it may exhibit enhanced stability and altered metabolic pathways compared to its non-fluorinated counterpart. 5-Fluoroarachidonic acid is of interest in biochemical research, particularly in studies related to lipid signaling and the modulation of inflammatory responses. Its potential applications may extend to pharmacology and therapeutic development, where understanding its interactions with biological systems can lead to novel insights into disease mechanisms and treatment strategies. However, detailed studies on its specific biological activities and safety profile are essential for evaluating its utility in clinical settings.
Formula:C20H31FO2
InChI:InChI=1/C20H31FO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-16-19(21)17-15-18-20(22)23/h6-7,9-10,12-13,16H,2-5,8,11,14-15,17-18H2,1H3,(H,22,23)/b7-6-,10-9-,13-12-,19-16+
Synonyms:- 5-Fluorotetraenoic acid
- (5E,8Z,11Z,14Z)-5-fluoroicosa-5,8,11,14-tetraenoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.