CAS 109522-62-5
:bromo-(2-ethoxy-1,1-difluoro-2-oxo-ethyl)zinc
Description:
Bromo-(2-ethoxy-1,1-difluoro-2-oxo-ethyl)zinc, with the CAS number 109522-62-5, is an organozinc compound that typically features a zinc atom coordinated to a bromo-substituted ethoxy group and a difluoro-2-oxoethyl moiety. This compound is characterized by its reactivity, particularly in organic synthesis, where it can serve as a nucleophile in various coupling reactions. The presence of the difluoro and ethoxy groups enhances its electrophilic properties, making it useful in the formation of carbon-carbon bonds. Additionally, the bromo substituent can facilitate further functionalization or substitution reactions. Organozinc compounds like this one are generally stable under anhydrous conditions but can be sensitive to moisture and air, which may lead to hydrolysis or oxidation. Its applications are often found in the synthesis of complex organic molecules, including pharmaceuticals and agrochemicals, due to its ability to participate in cross-coupling reactions and other transformations. Proper handling and storage conditions are essential to maintain its integrity and reactivity.
Formula:C4H5BrF2O2Zn
InChI:InChI=1/C4H5F2O2.BrH.Zn/c1-2-8-4(7)3(5)6;;/h2H2,1H3;1H;/q;;+1/p-1/rC4H5BrF2O2Zn/c1-2-9-3(8)4(6,7)10-5/h2H2,1H3
SMILES:CCOC(=C(F)F)O.Br.[Zn]
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.