
CAS 109532-23-2
:1-(2-Amino-4-methylphenyl)-2-chloroethanone
Description:
1-(2-Amino-4-methylphenyl)-2-chloroethanone, with the CAS number 109532-23-2, is an organic compound characterized by its functional groups, including an amine and a ketone. This compound features a chloroethanone moiety, which contributes to its reactivity and potential applications in organic synthesis. The presence of the amino group indicates that it may exhibit basic properties and can participate in various chemical reactions, such as nucleophilic substitutions. The methyl group on the aromatic ring can influence the compound's electronic properties and steric hindrance, affecting its reactivity and interactions with other molecules. This substance may be of interest in medicinal chemistry and material science due to its structural features, which could lead to the development of biologically active compounds or novel materials. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks or environmental hazards.
Formula:C9H10ClNO
InChI:InChI=1S/C9H10ClNO/c1-6-2-3-7(8(11)4-6)9(12)5-10/h2-4H,5,11H2,1H3
InChI key:InChIKey=BEZVNVUGWZWWDY-UHFFFAOYSA-N
SMILES:C(CCl)(=O)C1=C(N)C=C(C)C=C1
Synonyms:- 1-(2-Amino-4-methylphenyl)-2-chloroethanone
- Ethanone, 1-(2-amino-4-methylphenyl)-2-chloro-
- 1-(2-Amino-4-methylphenyl)-2-chloroethan-1-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.