CAS 109537-55-5

3-[(2-Furanylmethyl)dithio]-2-methylfuran

Description:

3-[(2-Furanylmethyl)dithio]-2-methylfuran, with the CAS number 109537-55-5, is an organic compound characterized by its unique structure that includes a furan ring and a dithioether functional group. This compound features a methyl group attached to a furan ring, contributing to its aromatic properties, while the dithioether linkage introduces potential reactivity due to the presence of sulfur atoms. The presence of the furan moiety suggests that it may exhibit interesting electronic properties and could participate in various chemical reactions, such as electrophilic substitutions or nucleophilic attacks. Additionally, compounds containing furan and sulfur functionalities are often studied for their biological activities, including antimicrobial and antioxidant properties. The solubility and stability of this compound can vary depending on the solvent and environmental conditions, making it relevant in both synthetic and medicinal chemistry contexts. Overall, 3-[(2-Furanylmethyl)dithio]-2-methylfuran represents a class of compounds that may have applications in pharmaceuticals, agrochemicals, and materials science.

Formula: C₁₀H₁₀O₂S₂

InChI: InChI=1S/C10H10O2S2/c1-8-10(4-6-11-8)14-13-7-9-3-2-5-12-9/h2-6H,7H2,1H3

InChI key: InChIKey=FVCZDGBJCOHRKY-UHFFFAOYSA-N

SMILES: S(SCC1=CC=CO1)C2=C(C)OC=C2

Synonyms:

• Furan, 3-[(2-furanylmethyl)dithio]-2-methyl-
• 3-[[(Furan-2-yl)methyl]disulfanyl]-2-methylfuran
• (2-Methyl-3-furyl) furfuryl disulfide
• 3-[(2-Furanylmethyl)dithio]-2-methylfuran