CAS 109544-15-2

4-(4-Chlorophenyl)-2-oxazolemethanol

Description:

4-(4-Chlorophenyl)-2-oxazolemethanol, identified by its CAS number 109544-15-2, is a chemical compound characterized by its oxazole ring structure, which is a five-membered heterocyclic compound containing both nitrogen and oxygen atoms. The presence of the 4-chlorophenyl group indicates that there is a chlorine substituent on a phenyl ring, contributing to the compound's potential biological activity and lipophilicity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its functional groups suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the oxazole moiety's known biological properties. Additionally, the chlorophenyl group may enhance the compound's interaction with biological targets. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity or reactivity. Overall, 4-(4-Chlorophenyl)-2-oxazolemethanol represents a compound of interest in various chemical and pharmaceutical research contexts.

Formula: C₁₀H₈ClNO₂

InChI: InChI=1S/C10H8ClNO2/c11-8-3-1-7(2-4-8)9-6-14-10(5-13)12-9/h1-4,6,13H,5H2

InChI key: InChIKey=LRBAUESIMPEDQH-UHFFFAOYSA-N

SMILES: C(O)C1=NC(=CO1)C2=CC=C(Cl)C=C2

Synonyms:

• 4-(4-Chlorophenyl)-2-oxazolemethanol
• (4-(4-Chlorophenyl)oxazol-2-yl)methanol
• [4-(4-Chlorophenyl)-1,3-oxazol-2-yl]methanol
• 2-Oxazolemethanol, 4-(4-chlorophenyl)-