CAS 109545-09-7
:5-[2-(dimethylamino)ethyl]-2-(4-methoxyphenyl)-4-oxo-2,3,4,5-tetrahydro-1,5-benzothiazepin-3-yl pyridine-3-carboxylate
Description:
The chemical substance known as 5-[2-(dimethylamino)ethyl]-2-(4-methoxyphenyl)-4-oxo-2,3,4,5-tetrahydro-1,5-benzothiazepin-3-yl pyridine-3-carboxylate, with the CAS number 109545-09-7, is a complex organic compound characterized by its multi-cyclic structure, which includes a benzothiazepine core. This compound features various functional groups, including a pyridine carboxylate and a dimethylaminoethyl side chain, contributing to its potential biological activity. The presence of the methoxyphenyl group suggests possible interactions with biological targets, making it of interest in medicinal chemistry. Its structural complexity may influence its solubility, stability, and reactivity, which are critical factors in pharmacological applications. Additionally, the compound's unique arrangement of atoms and functional groups may impart specific properties such as lipophilicity and polarity, affecting its bioavailability and mechanism of action. Overall, this substance represents a class of compounds that may exhibit diverse pharmacological effects, warranting further investigation for therapeutic potential.
Formula:C26H27N3O4S
InChI:InChI=1/C26H27N3O4S/c1-28(2)15-16-29-21-8-4-5-9-22(21)34-24(18-10-12-20(32-3)13-11-18)23(25(29)30)33-26(31)19-7-6-14-27-17-19/h4-14,17,23-24H,15-16H2,1-3H3
Synonyms:- 3-Pyridinecarboxylic acid, 5-(2-(dimethylamino)ethyl)-2,3,4,5-tetrahydro-2-(4-methoxyphenyl)-4-oxo-1,5-benzothiazepin-3-yl ester
- (2S,3S)-2,3-Dihydro-5-(2-dimethylaminoethyl)-2-(4-methoxyphenyl)-3-(3-pyridinylcarbonyloxy)-1,5-benzothiazepine-4(5H)-one
- SAS 1310
- 3-Pyridinecarboxylic acid [(2S,3S)-5-[2-(dimethylamino)ethyl]-2,3,4,5-tetrahydro-2-(4-methoxyphenyl)-4-oxo-1,5-benzothiazepine]-3-yl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Sas 1310
CAS:Sas 1310 is a diltiazem derivative that acts as a calcium antagonist.Formula:C26H27N3O4SColor and Shape:SolidMolecular weight:477.58
