CAS 1095545-14-4

Pyrrolidine, 3-(2-chlorophenyl)-, hydrochloride (1:1)

Description:

Pyrrolidine, 3-(2-chlorophenyl)-, hydrochloride (1:1) is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered saturated heterocycle containing one nitrogen atom. The presence of a 2-chlorophenyl group indicates that a chlorinated phenyl substituent is attached to the third position of the pyrrolidine ring, influencing its chemical properties and biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which enhances its utility in pharmaceutical applications. This compound may exhibit various pharmacological effects, potentially acting as a neurotransmitter modulator or having implications in medicinal chemistry. Its molecular interactions, stability, and reactivity can be influenced by the presence of the chlorine atom, which can affect lipophilicity and biological interactions. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory or industrial settings.

Formula: C₁₀H₁₂ClN·ClH

InChI: InChI=1S/C10H12ClN.ClH/c11-10-4-2-1-3-9(10)8-5-6-12-7-8;/h1-4,8,12H,5-7H2;1H

InChI key: InChIKey=QNOZWUMAYVLCKF-UHFFFAOYSA-N

SMILES: ClC1=C(C2CCNC2)C=CC=C1.Cl

Synonyms:

• Pyrrolidine, 3-(2-chlorophenyl)-, hydrochloride (1:1)

3-(2-Chlorophenyl)pyrrolidine, HCl

CAS: 1095545-14-4

Formula: C₁₀H₁₃Cl₂N

Purity: 95%

Color and Shape: Solid

Molecular weight: 218.1229

Ref: IN-DA008RPE

3-(2-Chlorophenyl)pyrrolidine hydrochloride

CAS: 1095545-14-4

Formula: C₁₀H₁₃Cl₂N

Purity: 95%

Color and Shape: Solid

Molecular weight: 218.12

Ref: 10-F079252