CAS 1095714-91-2
:4-[1-Hydroxy-2-[methyl(phenylmethyl)amino]ethyl]-1,2-benzenediol
Description:
4-[1-Hydroxy-2-[methyl(phenylmethyl)amino]ethyl]-1,2-benzenediol, with the CAS number 1095714-91-2, is a chemical compound characterized by its complex structure, which includes a benzene ring substituted with hydroxyl groups and an aminoalkyl side chain. This compound features a hydroxyl group at the 4-position of the benzene ring and a side chain that incorporates a methyl group and a phenylmethyl group, contributing to its potential biological activity. The presence of both hydroxyl and amino functional groups suggests that it may exhibit properties such as solubility in polar solvents and the ability to form hydrogen bonds, which can influence its reactivity and interaction with biological systems. Additionally, the compound may have implications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that could interact with biological targets. However, specific data regarding its toxicity, stability, and applications would require further investigation and analysis.
Formula:C16H19NO3
InChI:InChI=1S/C16H19NO3/c1-17(10-12-5-3-2-4-6-12)11-16(20)13-7-8-14(18)15(19)9-13/h2-9,16,18-20H,10-11H2,1H3
InChI key:InChIKey=YENHZTNWVCNPRW-UHFFFAOYSA-N
SMILES:C(CN(CC1=CC=CC=C1)C)(O)C2=CC(O)=C(O)C=C2
Synonyms:- 4-[1-Hydroxy-2-[methyl(phenylmethyl)amino]ethyl]-1,2-benzenediol
- 1,2-Benzenediol, 4-[1-hydroxy-2-[methyl(phenylmethyl)amino]ethyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
rac-Adrenaline EP Impurity D HCl
CAS:Formula:C16H19NO3·HClColor and Shape:White To Off-White SolidMolecular weight:273.33 36.46N-Benzyl Epinephrine
CAS:Applications N-Benzyl Epinephrine is an impurity of Epinephrine (E588580).
Formula:C16H19NO3Color and Shape:Off White SolidMolecular weight:273.33


