CAS 1095822-23-3

Ethyl 4-amino-6-chloro-5-pyrimidineacetate

Description:

Ethyl 4-amino-6-chloro-5-pyrimidineacetate is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered heterocyclic aromatic ring containing nitrogen atoms. The presence of an amino group (-NH2) at the 4-position and a chloro group (-Cl) at the 6-position of the pyrimidine ring contributes to its reactivity and potential biological activity. The ethyl ester functional group at the 5-position enhances its solubility in organic solvents, making it suitable for various applications in medicinal chemistry and agrochemicals. This compound may exhibit properties such as antimicrobial or herbicidal activity, typical of many pyrimidine derivatives. Its molecular structure allows for potential interactions with biological targets, which can be explored in drug development or agricultural applications. As with many chemical substances, safety data and handling precautions should be considered, as the presence of chlorine and amino groups can influence toxicity and environmental impact.

Formula: C₈H₁₀ClN₃O₂

InChI: InChI=1S/C8H10ClN3O2/c1-2-14-6(13)3-5-7(9)11-4-12-8(5)10/h4H,2-3H2,1H3,(H2,10,11,12)

InChI key: InChIKey=VWKQPLPIQGMUAQ-UHFFFAOYSA-N

SMILES: C(C(OCC)=O)C=1C(Cl)=NC=NC1N

Synonyms:

• Ethyl 4-amino-6-chloro-5-pyrimidineacetate
• 5-Pyrimidineacetic acid, 4-amino-6-chloro-, ethyl ester