CAS 109605-79-0
:5,7-dihydroxy-2-(4-hydroxyphenyl)-3-methoxy-6-(3-methylbut-2-en-1-yl)-4H-chromen-4-one
Description:
5,7-Dihydroxy-2-(4-hydroxyphenyl)-3-methoxy-6-(3-methylbut-2-en-1-yl)-4H-chromen-4-one, with the CAS number 109605-79-0, is a flavonoid compound characterized by its complex polyphenolic structure. This compound features multiple hydroxyl groups, which contribute to its potential antioxidant properties, and a methoxy group that can influence its solubility and reactivity. The presence of a chromenone backbone is typical of flavonoids, suggesting biological activity, including anti-inflammatory and anticancer effects. The 3-methylbut-2-en-1-yl substituent may enhance its lipophilicity, potentially affecting its bioavailability and interaction with biological membranes. This compound is of interest in pharmacological research due to its structural diversity and potential therapeutic applications. Its solubility, stability, and reactivity can vary based on environmental conditions, making it a subject of study in both synthetic and natural product chemistry. Overall, this flavonoid exemplifies the intricate relationship between chemical structure and biological activity, warranting further investigation into its applications in health and medicine.
Formula:C21H20O6
InChI:InChI=1/C21H20O6/c1-11(2)4-9-14-15(23)10-16-17(18(14)24)19(25)21(26-3)20(27-16)12-5-7-13(22)8-6-12/h4-8,10,22-24H,9H2,1-3H3
SMILES:CC(=CCc1c(cc2c(c1O)c(=O)c(c(c1ccc(cc1)O)o2)OC)O)C
Synonyms:- 5,7-Dihydroxy-2-(4-hydroxy-phenyl)-3-methoxy-6-(3-methyl-but-2-enyl)-1-benzopyran-4-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Topazolin
CAS:<p>Topazolin has weak fungitoxic activity, it displays significant activity against Salmonella typhimurium ATCC 13311 with MIC values ranging from 2 to 8 ug/mL, it</p>Formula:C21H20O6Purity:98%Color and Shape:SolidMolecular weight:368.38Topazolin
CAS:<p>Topazolin is currently an unspecified or unavailable product name, and as such, detailed information regarding its type, source, mode of action, and applications cannot be provided. If Topazolin pertains to a specific field or is known under a different context, please provide additional details to enable a more precise scientific description and discussion.</p>Formula:C21H20O6Purity:Min. 95%Molecular weight:368.4 g/mol


