CAS 109613-91-4
:2-Chloro-3-methoxy-4-nitropyridine
Description:
2-Chloro-3-methoxy-4-nitropyridine is a heterocyclic organic compound characterized by its pyridine ring, which is substituted at the 2, 3, and 4 positions. The presence of a chlorine atom at the 2-position, a methoxy group (-OCH3) at the 3-position, and a nitro group (-NO2) at the 4-position contributes to its unique chemical properties. This compound is typically a yellow to brown solid and is soluble in organic solvents. It exhibits polar characteristics due to the electronegative substituents, which can influence its reactivity and interactions in chemical reactions. The nitro group is known for its electron-withdrawing properties, which can affect the compound's acidity and nucleophilicity. 2-Chloro-3-methoxy-4-nitropyridine may be utilized in various applications, including pharmaceuticals and agrochemicals, due to its potential biological activity. Safety precautions should be observed when handling this compound, as it may pose health risks, including toxicity and environmental hazards.
Formula:C6H5ClN2O3
InChI:InChI=1S/C6H5ClN2O3/c1-12-5-4(9(10)11)2-3-8-6(5)7/h2-3H,1H3
InChI key:InChIKey=LJNLOXQPMZAWIX-UHFFFAOYSA-N
SMILES:O(C)C=1C(N(=O)=O)=CC=NC1Cl
Synonyms:- 2-Chloro-3-methoxy-4-nitropyridine
- Pyridine, 2-chloro-3-methoxy-4-nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
