CymitQuimica logo

CAS 109613-92-5

:

2,3,4-Trimethoxypyridine

Description:
2,3,4-Trimethoxypyridine is an organic compound characterized by its pyridine ring substituted with three methoxy groups at the 2, 3, and 4 positions. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its form and purity. It is known for its aromatic properties and can exhibit a range of biological activities, making it of interest in medicinal chemistry and agricultural applications. The presence of methoxy groups enhances its solubility in organic solvents and may influence its reactivity and interaction with biological targets. 2,3,4-Trimethoxypyridine is generally stable under standard conditions but should be handled with care due to potential toxicity. Its synthesis often involves the methylation of pyridine derivatives, and it can be analyzed using techniques such as NMR and mass spectrometry to confirm its structure and purity. As with many pyridine derivatives, it may participate in various chemical reactions, including electrophilic substitutions and nucleophilic attacks, making it a versatile building block in organic synthesis.
Formula:C8H11NO3
InChI:InChI=1S/C8H11NO3/c1-10-6-4-5-9-8(12-3)7(6)11-2/h4-5H,1-3H3
InChI key:InChIKey=XJUVFUPQCATDHB-UHFFFAOYSA-N
SMILES:O(C)C=1C(OC)=CC=NC1OC
Synonyms:
  • Pyridine, 2,3,4-trimethoxy-
  • 2,3,4-Trimethoxypyridine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.