CAS 109636-76-2

2-cyano-N-(4-hydroxyphenyl)-3-(1-methyl-1H-pyrrol-2-yl)-3-oxopropanamide - 2-amino-2-(hydroxymethyl)propane-1,3-diol (1:1)

Description:

2-Cyano-N-(4-hydroxyphenyl)-3-(1-methyl-1H-pyrrol-2-yl)-3-oxopropanamide - 2-amino-2-(hydroxymethyl)propane-1,3-diol (1:1), with CAS number 109636-76-2, is a complex organic compound characterized by its multifunctional structure. It features a cyano group, which contributes to its reactivity, and a hydroxyl group that enhances its solubility in polar solvents. The presence of the pyrrole moiety suggests potential biological activity, as pyrrole derivatives are often found in various natural products and pharmaceuticals. The compound also contains a propanamide functional group, indicating potential for hydrogen bonding and interactions with biological targets. Additionally, the inclusion of a diol component suggests it may exhibit properties such as increased stability and solubility in aqueous environments. Overall, this compound's unique structural features may lend it applications in medicinal chemistry, particularly in the development of bioactive molecules or as intermediates in organic synthesis. However, specific properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.

Formula: C₁₉H₂₄N₄O₆

InChI: InChI=1/C15H13N3O3.C4H11NO3/c1-18-8-2-3-13(18)14(20)12(9-16)15(21)17-10-4-6-11(19)7-5-10;5-4(1-6,2-7)3-8/h2-8,12,19H,1H3,(H,17,21);6-8H,1-3,5H2

Synonyms:

• PRINOMIDE TROMETHAMINE
• CGS 10787D
• 109636-76-2

Prinomide tromethamine

CAS: 109636-76-2

Prinomide tromethamine

Purity: ≥98%

Molecular weight: 388.42g/mol

Ref: 54-BUP15195

Prinomide tromethamine

CAS: 109636-76-2

Prinomide tromethamine is an antirheumatic compound.

Formula: C₁₉H₂₄N₄O₅

Purity: 99.67%

Color and Shape: Solid

Molecular weight: 388.42

Ref: TM-T25986