CAS 109651-02-7

4-AMINO-N-(4-ETHOXYPHENYL)BENZAMIDE HYDROCHLORIDE

Description:

4-Amino-N-(4-ethoxyphenyl)benzamide hydrochloride is a chemical compound characterized by its amide functional group and an amino group attached to a benzene ring. This compound features an ethoxy substituent on the para position of the phenyl ring, which contributes to its solubility and reactivity. As a hydrochloride salt, it is typically more stable and soluble in aqueous solutions compared to its free base form. The presence of the amino group suggests potential basicity, while the ethoxy group may influence its lipophilicity and biological activity. This compound may be of interest in pharmaceutical research due to its structural features that could interact with biological targets. Its molecular structure allows for various applications, including potential use in drug development or as a reagent in organic synthesis. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper laboratory practices.

Formula: C₁₅H₁₆N₂O₂

InChI: InChI=1/C15H16N2O2/c1-2-19-14-9-7-13(8-10-14)17-15(18)11-3-5-12(16)6-4-11/h3-10H,2,16H2,1H3,(H,17,18)

SMILES: CCOc1ccc(cc1)N=C(c1ccc(cc1)N)O

Synonyms:

• 4-Amino-N-(4-ethoxy-phenyl)-benzamide

4-Amino-N-(4-ethoxyphenyl)benzamide

CAS: 109651-02-7

Versatile small molecule scaffold

Formula: C₁₅H₁₆N₂O₂

Purity: Min. 95%

Molecular weight: 256.3 g/mol

Ref: 3D-JEA65102