CAS 109664-02-0

1-hydroxy-2-(1-hydroxypropan-2-yl)-8,8-dimethyl-5,6,7,8-tetrahydrophenanthrene-3,4-dione

Description:

1-Hydroxy-2-(1-hydroxypropan-2-yl)-8,8-dimethyl-5,6,7,8-tetrahydrophenanthrene-3,4-dione, with the CAS number 109664-02-0, is a complex organic compound characterized by its polycyclic structure, which includes a phenanthrene core. This compound features multiple functional groups, including hydroxyl (-OH) groups and ketone (=O) groups, contributing to its reactivity and potential biological activity. The presence of the dimethyl and hydroxypropan-2-yl substituents indicates that it may exhibit steric hindrance, influencing its interactions with other molecules. The compound's structure suggests it may participate in various chemical reactions, including oxidation and reduction processes. Additionally, due to its polycyclic nature, it may exhibit interesting optical properties and could be relevant in fields such as organic synthesis, medicinal chemistry, or materials science. However, specific applications and biological activities would require further investigation through empirical studies.

Formula: C₁₉H₂₂O₄

InChI: InChI=1/C19H22O4/c1-10(9-20)14-16(21)12-6-7-13-11(5-4-8-19(13,2)3)15(12)18(23)17(14)22/h6-7,10,20-21H,4-5,8-9H2,1-3H3

SMILES: CC(CO)C1=C(c2ccc3c(CCCC3(C)C)c2C(=O)C1=O)O

Neocryptotanshinone

CAS: 109664-02-0

Formula: C₁₉H₂₂O₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 314.3756

Ref: IN-DA0096QD

(R)-3-Hydroxy-2-(1-hydroxypropan-2-yl)-8,8-dimethyl-5,6,7,8-tetrahydrophenanthrene-1,4-dione

CAS: 109664-02-0

(R)-3-Hydroxy-2-(1-hydroxypropan-2-yl)-8,8-dimethyl-5,6,7,8-tetrahydrophenanthrene-1,4-dione

Purity: 97%

Molecular weight: 314.38g/mol

Ref: 54-OR1055017

Neocryptotanshinone

CAS: 109664-02-0

Formula: C₁₉H₂₂O₄

Molecular weight: 314.38

Ref: 7W-GY8125

Neocryptotanshinone

CAS: 109664-02-0

Neocryptotanshinone, a natural product, inhibits LPS-induced inflammation in RAW264.7 macrophages by suppressing NF-κB and iNOS signalling pathways.

Formula: C₁₉H₂₂O₄

Purity: 98.99%

Color and Shape: Solid

Molecular weight: 314.38

Ref: TM-TN1980

Neocryptotanshinone

CAS: 109664-02-0

Formula: C₁₉H₂₂O₄

Purity: 95%~99%

Molecular weight: 314.381

Ref: BP-BPF2181

Neocryptotanshinone

CAS: 109664-02-0

Neocryptotanshinone is a bioactive compound, which is a naturally occurring diterpene quinone derivative. This product is primarily sourced from the roots of Salvia miltiorrhiza, commonly known as Danshen, a plant extensively used in traditional Chinese medicine. It exhibits a complex mode of action, primarily involving the modulation of signaling pathways critical to cellular functions. Specifically, neocryptotanshinone has been observed to inhibit certain kinases and transcription factors, impacting cell cycle regulation and apoptosis.

Formula: C₁₉H₂₂O₄

Purity: Min. 95%

Molecular weight: 314.38 g/mol

Ref: 3D-JEA66402