CAS 1096666-13-5

3H-Imidazo[4,5-c]pyridine-6-methanol

Description:

3H-Imidazo[4,5-c]pyridine-6-methanol is a heterocyclic organic compound characterized by its fused imidazole and pyridine rings, which contribute to its unique chemical properties. This compound features a hydroxymethyl group (-CH2OH) at the 6-position of the imidazo ring, enhancing its potential for hydrogen bonding and reactivity. The presence of nitrogen atoms in the ring structure imparts basicity and can influence its interaction with biological targets, making it of interest in medicinal chemistry. The compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the hydroxymethyl group. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of compounds with antimicrobial or anticancer properties. Additionally, the compound's stability and reactivity can be influenced by the presence of substituents on the ring, which can be modified to optimize its biological activity. Overall, 3H-Imidazo[4,5-c]pyridine-6-methanol represents a versatile scaffold for further chemical exploration and development.

Formula: C₇H₇N₃O

InChI: InChI=1S/C7H7N3O/c11-3-5-1-6-7(2-8-5)10-4-9-6/h1-2,4,11H,3H2,(H,9,10)

InChI key: InChIKey=XAKKBCIWUUXERA-UHFFFAOYSA-N

SMILES: C(O)C=1C=C2C(=CN1)N=CN2

Synonyms:

• 1H-Imidazo[4,5-c]pyridin-6-ylmethanol
• [3H-Imidazo[4,5-c]pyridin-6-yl]methanol
• 3H-Imidazo[4,5-c]pyridine-6-methanol